C26H30Cl2N2O3 — CID 59143916
tert-butyl N-[(1S,4S)-7-(cyclopropylcarbamoyl)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate (PubChem CID 59143916) has the molecular formula C26H30Cl2N2O3 and a molecular weight of 489.44 g/mol. Its IUPAC name is tert-butyl N-[(1S,4S)-7-(cyclopropylcarbamoyl)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1S,4S)-7-(cyclopropylcarbamoyl)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59143916 |
| Molecular Formula | C26H30Cl2N2O3 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | tert-butyl N-[(1S,4S)-7-(cyclopropylcarbamoyl)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccc(C(=O)NC3CC3)cc21 |
| InChI | InChI=1S/C26H30Cl2N2O3/c1-26(2,3)33-25(32)30(4)23-12-10-18(15-6-11-21(27)22(28)14-15)19-9-5-16(13-20(19)23)24(31)29-17-7-8-17/h5-6,9,11,13-14,17-18,23H,7-8,10,12H2,1-4H3,(H,29,31)/t18-,23-/m0/s1 |
| InChIKey | AGNKIMBEFFMHME-MBSDFSHPSA-N |
| XLogP | 6.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |