C23H26Cl2N2O — CID 59143866
(5S,8S)-N-cyclopropyl-5-(3,4-dichlorophenyl)-8-(dimethylamino)-N-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 59143866) has the molecular formula C23H26Cl2N2O and a molecular weight of 417.38 g/mol. Its IUPAC name is (5S,8S)-N-cyclopropyl-5-(3,4-dichlorophenyl)-8-(dimethylamino)-N-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | (5S,8S)-N-cyclopropyl-5-(3,4-dichlorophenyl)-8-(dimethylamino)-N-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 59143866 |
| Molecular Formula | C23H26Cl2N2O |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (5S,8S)-N-cyclopropyl-5-(3,4-dichlorophenyl)-8-(dimethylamino)-N-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)[C@@H](N(C)C)CC[C@H]2c1ccc(Cl)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C23H26Cl2N2O/c1-26(2)22-11-9-17(14-5-10-20(24)21(25)13-14)18-8-4-15(12-19(18)22)23(28)27(3)16-6-7-16/h4-5,8,10,12-13,16-17,22H,6-7,9,11H2,1-3H3/t17-,22-/m0/s1 |
| InChIKey | BWKQSSUHRREHRM-JTSKRJEESA-N |
| XLogP | 5.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |