C24H27Cl2NO4 — CID 59143820
methyl (5S,8S)-5-(3,4-dichlorophenyl)-8-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate (PubChem CID 59143820) has the molecular formula C24H27Cl2NO4 and a molecular weight of 464.39 g/mol. Its IUPAC name is methyl (5S,8S)-5-(3,4-dichlorophenyl)-8-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate.
| Compound Name | methyl (5S,8S)-5-(3,4-dichlorophenyl)-8-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59143820 |
| Molecular Formula | C24H27Cl2NO4 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | methyl (5S,8S)-5-(3,4-dichlorophenyl)-8-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@@H](N(C)C(=O)OC(C)(C)C)CC[C@H]2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H27Cl2NO4/c1-24(2,3)31-23(29)27(4)21-11-9-16(14-7-10-19(25)20(26)13-14)17-8-6-15(12-18(17)21)22(28)30-5/h6-8,10,12-13,16,21H,9,11H2,1-5H3/t16-,21-/m0/s1 |
| InChIKey | NMUVZEVHFPGGMG-KKSFZXQISA-N |
| XLogP | 6.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |