C27H34Cl2N2O4 — CID 139933175
tert-butyl N-[(1S,4S)-4-(3,4-dichlorophenyl)-6-[3-(2-hydroxyethylamino)-3-oxopropyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate (PubChem CID 139933175) has the molecular formula C27H34Cl2N2O4 and a molecular weight of 521.49 g/mol. Its IUPAC name is tert-butyl N-[(1S,4S)-4-(3,4-dichlorophenyl)-6-[3-(2-hydroxyethylamino)-3-oxopropyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1S,4S)-4-(3,4-dichlorophenyl)-6-[3-(2-hydroxyethylamino)-3-oxopropyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 139933175 |
| Molecular Formula | C27H34Cl2N2O4 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | tert-butyl N-[(1S,4S)-4-(3,4-dichlorophenyl)-6-[3-(2-hydroxyethylamino)-3-oxopropyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2cc(CCC(=O)NCCO)ccc21 |
| InChI | InChI=1S/C27H34Cl2N2O4/c1-27(2,3)35-26(34)31(4)24-11-9-19(18-7-10-22(28)23(29)16-18)21-15-17(5-8-20(21)24)6-12-25(33)30-13-14-32/h5,7-8,10,15-16,19,24,32H,6,9,11-14H2,1-4H3,(H,30,33)/t19-,24-/m0/s1 |
| InChIKey | FZEZHRYLGXQXCS-CYFREDJKSA-N |
| XLogP | 5.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |