C35H49Cl2N2O6P — CID 157449729
6-[[11-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-4,11-dioxoundecanoyl]amino]hexoxy-methylphosphinic acid (PubChem CID 157449729) has the molecular formula C35H49Cl2N2O6P and a molecular weight of 695.66 g/mol. Its IUPAC name is 6-[[11-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-4,11-dioxoundecanoyl]amino]hexoxy-methylphosphinic acid.
| Compound Name | 6-[[11-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-4,11-dioxoundecanoyl]amino]hexoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 157449729 |
| Molecular Formula | C35H49Cl2N2O6P |
| Molecular Weight | 695.66 g/mol |
| Exact Mass | 694.27 |
| IUPAC Name | 6-[[11-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-4,11-dioxoundecanoyl]amino]hexoxy-methylphosphinic acid |
| SMILES | CN(C(=O)CCCCCCC(=O)CCC(=O)NCCCCCCOP(C)(=O)O)[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C35H49Cl2N2O6P/c1-39(33-21-19-28(29-14-9-10-15-30(29)33)26-17-20-31(36)32(37)25-26)35(42)16-8-4-3-7-13-27(40)18-22-34(41)38-23-11-5-6-12-24-45-46(2,43)44/h9-10,14-15,17,20,25,28,33H,3-8,11-13,16,18-19,21-24H2,1-2H3,(H,38,41)(H,43,44)/t28-,33-/m0/s1 |
| InChIKey | DCFGAXHLHICQLF-UVMMSNCQSA-N |
| XLogP | 8.62 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.66 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|