C32H44Cl2NO6P — CID 159149776
[14-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-7,14-dioxotetradecyl] methyl hydrogen phosphate (PubChem CID 159149776) has the molecular formula C32H44Cl2NO6P and a molecular weight of 640.58 g/mol. Its IUPAC name is [14-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-7,14-dioxotetradecyl] methyl hydrogen phosphate.
| Compound Name | [14-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-7,14-dioxotetradecyl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 159149776 |
| Molecular Formula | C32H44Cl2NO6P |
| Molecular Weight | 640.58 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | [14-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-7,14-dioxotetradecyl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCCCCCCC(=O)CCCCCCC(=O)N(C)[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C32H44Cl2NO6P/c1-35(31-21-19-26(27-15-10-11-16-28(27)31)24-18-20-29(33)30(34)23-24)32(37)17-9-4-3-7-13-25(36)14-8-5-6-12-22-41-42(38,39)40-2/h10-11,15-16,18,20,23,26,31H,3-9,12-14,17,19,21-22H2,1-2H3,(H,38,39)/t26-,31-/m0/s1 |
| InChIKey | KJCZWXGDJIVHBC-HVNZXBJASA-N |
| XLogP | 9.04 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.58 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|