C21H23Cl2IN2O2 — CID 142014635
tert-butyl N-[(4S)-7-amino-4-(3,4-dichlorophenyl)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate (PubChem CID 142014635) has the molecular formula C21H23Cl2IN2O2 and a molecular weight of 533.24 g/mol. Its IUPAC name is tert-butyl N-[(4S)-7-amino-4-(3,4-dichlorophenyl)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(4S)-7-amino-4-(3,4-dichlorophenyl)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 142014635 |
| Molecular Formula | C21H23Cl2IN2O2 |
| Molecular Weight | 533.24 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | tert-butyl N-[(4S)-7-amino-4-(3,4-dichlorophenyl)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2cc(I)c(N)cc21 |
| InChI | InChI=1S/C21H23Cl2IN2O2/c1-21(2,3)28-20(27)26-19-7-5-12(11-4-6-15(22)16(23)8-11)13-9-17(24)18(25)10-14(13)19/h4,6,8-10,12,19H,5,7,25H2,1-3H3,(H,26,27)/t12-,19?/m0/s1 |
| InChIKey | WMGNTQXYWHULBE-HSLMYDHPSA-N |
| XLogP | 6.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.24 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|