C9H17FmN2O5- — CID 171825179
fermium;methanol;2-methyl-N-(2-oxoethoxymethyl)-2-(oxomethylamino)propanamide (PubChem CID 171825179) has the molecular formula C9H17FmN2O5- and a molecular weight of 490.24 g/mol. Its IUPAC name is fermium;methanol;2-methyl-N-(2-oxoethoxymethyl)-2-(oxomethylamino)propanamide.
| Compound Name | fermium;methanol;2-methyl-N-(2-oxoethoxymethyl)-2-(oxomethylamino)propanamide |
|---|---|
| PubChem CID | 171825179 |
| Molecular Formula | C9H17FmN2O5- |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | fermium;methanol;2-methyl-N-(2-oxoethoxymethyl)-2-(oxomethylamino)propanamide |
| SMILES | CC(C)(N[C-]=O)C(=O)NCOCC=O.CO.[Fm] |
| InChI | InChI=1S/C8H13N2O4.CH4O.Fm/c1-8(2,10-5-12)7(13)9-6-14-4-3-11;1-2;/h3H,4,6H2,1-2H3,(H,9,13)(H,10,12);2H,1H3;/q-1;; |
| InChIKey | CKSQCTVFXOFFKF-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|