C9H13F2NO — CID 171833064
5-(difluoromethoxy)-6-propan-2-yl-1,2-dihydropyridine (PubChem CID 171833064) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is 5-(difluoromethoxy)-6-propan-2-yl-1,2-dihydropyridine.
| Compound Name | 5-(difluoromethoxy)-6-propan-2-yl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 171833064 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 5-(difluoromethoxy)-6-propan-2-yl-1,2-dihydropyridine |
| SMILES | CC(C)C1=C(OC(F)F)C=CCN1 |
| InChI | InChI=1S/C9H13F2NO/c1-6(2)8-7(13-9(10)11)4-3-5-12-8/h3-4,6,9,12H,5H2,1-2H3 |
| InChIKey | PNPJRGDSRONQBV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |