C23H26N4 — CID 171835643
2-[2-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]ethyl]benzonitrile (PubChem CID 171835643) has the molecular formula C23H26N4 and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[2-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]ethyl]benzonitrile.
| Compound Name | 2-[2-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 171835643 |
| Molecular Formula | C23H26N4 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 2-[2-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]ethyl]benzonitrile |
| SMILES | CN1CCN2c3c(cccc31)[C@@H]1CN(CCc3ccccc3C#N)CC[C@@H]12 |
| InChI | InChI=1S/C23H26N4/c1-25-13-14-27-21-10-12-26(11-9-17-5-2-3-6-18(17)15-24)16-20(21)19-7-4-8-22(25)23(19)27/h2-8,20-21H,9-14,16H2,1H3/t20-,21-/m0/s1 |
| InChIKey | GZWXYEBNQDQQMT-SFTDATJTSA-N |
| XLogP | 3.23 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |