C24H27FN4 — CID 177208130
12-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 177208130) has the molecular formula C24H27FN4 and a molecular weight of 390.51 g/mol. Its IUPAC name is 12-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | 12-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 177208130 |
| Molecular Formula | C24H27FN4 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 12-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | CN1CCN2c3c(cccc31)C1CN(CCc3c[nH]c4ccc(F)cc34)CCC12 |
| InChI | InChI=1S/C24H27FN4/c1-27-11-12-29-22-8-10-28(15-20(22)18-3-2-4-23(27)24(18)29)9-7-16-14-26-21-6-5-17(25)13-19(16)21/h2-6,13-14,20,22,26H,7-12,15H2,1H3 |
| InChIKey | IQUWWISVQREUGO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 25.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |