C23H25N3O — CID 177208568
(10R,15S)-12-(1-benzofuran-4-ylmethyl)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 177208568) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (10R,15S)-12-(1-benzofuran-4-ylmethyl)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | (10R,15S)-12-(1-benzofuran-4-ylmethyl)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 177208568 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (10R,15S)-12-(1-benzofuran-4-ylmethyl)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | CN1CCN2c3c(cccc31)[C@@H]1CN(Cc3cccc4occc34)CC[C@@H]12 |
| InChI | InChI=1S/C23H25N3O/c1-24-11-12-26-20-8-10-25(14-16-4-2-7-22-17(16)9-13-27-22)15-19(20)18-5-3-6-21(24)23(18)26/h2-7,9,13,19-20H,8,10-12,14-15H2,1H3/t19-,20-/m0/s1 |
| InChIKey | DPDPAEGVIGWGJZ-PMACEKPBSA-N |
| XLogP | 4.06 |
| TPSA | 22.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |