C44H82N4O5 — CID 171836765
pentyl 9-[(5-heptadecan-9-yloxy-5-oxopentyl)-[4-(1H-imidazole-5-carbonylamino)butyl]amino]nonanoate (PubChem CID 171836765) has the molecular formula C44H82N4O5 and a molecular weight of 747.16 g/mol. Its IUPAC name is pentyl 9-[(5-heptadecan-9-yloxy-5-oxopentyl)-[4-(1H-imidazole-5-carbonylamino)butyl]amino]nonanoate.
| Compound Name | pentyl 9-[(5-heptadecan-9-yloxy-5-oxopentyl)-[4-(1H-imidazole-5-carbonylamino)butyl]amino]nonanoate |
|---|---|
| PubChem CID | 171836765 |
| Molecular Formula | C44H82N4O5 |
| Molecular Weight | 747.16 g/mol |
| Exact Mass | 746.63 |
| IUPAC Name | pentyl 9-[(5-heptadecan-9-yloxy-5-oxopentyl)-[4-(1H-imidazole-5-carbonylamino)butyl]amino]nonanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCN(CCCCCCCCC(=O)OCCCCC)CCCCNC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C44H82N4O5/c1-4-7-10-12-16-20-29-40(30-21-17-13-11-8-5-2)53-43(50)32-23-26-35-48(36-27-24-33-46-44(51)41-38-45-39-47-41)34-25-19-15-14-18-22-31-42(49)52-37-28-9-6-3/h38-40H,4-37H2,1-3H3,(H,45,47)(H,46,51) |
| InChIKey | KBGUMPWPMLJTQP-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.16 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|