C27H33N3OS — CID 171838547
ethane;5-(3-propan-2-ylphenyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 171838547) has the molecular formula C27H33N3OS and a molecular weight of 447.65 g/mol. Its IUPAC name is ethane;5-(3-propan-2-ylphenyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | ethane;5-(3-propan-2-ylphenyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 171838547 |
| Molecular Formula | C27H33N3OS |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | ethane;5-(3-propan-2-ylphenyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | CC.CC.CC(C)c1cccc(-c2ccc3c(ccc4sc5c(c43)NCCNC5=O)n2)c1 |
| InChI | InChI=1S/C23H21N3OS.2C2H6/c1-13(2)14-4-3-5-15(12-14)17-7-6-16-18(26-17)8-9-19-20(16)21-22(28-19)23(27)25-11-10-24-21;2*1-2/h3-9,12-13,24H,10-11H2,1-2H3,(H,25,27);2*1-2H3 |
| InChIKey | IUNVBXAMSQPHFJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |