C29H29N5O2S — CID 144714901
N-[2-(1-methylpiperidin-4-yl)-5-(13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide (PubChem CID 144714901) has the molecular formula C29H29N5O2S and a molecular weight of 511.65 g/mol. Its IUPAC name is N-[2-(1-methylpiperidin-4-yl)-5-(13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-(1-methylpiperidin-4-yl)-5-(13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144714901 |
| Molecular Formula | C29H29N5O2S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | N-[2-(1-methylpiperidin-4-yl)-5-(13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2ccc3c(ccc4sc5c(c43)NCCNC5=O)n2)ccc1C1CCN(C)CC1 |
| InChI | InChI=1S/C29H29N5O2S/c1-3-25(35)33-23-16-18(4-5-19(23)17-10-14-34(2)15-11-17)21-7-6-20-22(32-21)8-9-24-26(20)27-28(37-24)29(36)31-13-12-30-27/h3-9,16-17,30H,1,10-15H2,2H3,(H,31,36)(H,33,35) |
| InChIKey | DLUZXDXOTTZTSF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|