C28H28N4O2S — CID 166461455
2-[1-[4-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]phenyl]piperidin-4-yl]acetaldehyde (PubChem CID 166461455) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-[1-[4-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]phenyl]piperidin-4-yl]acetaldehyde.
| Compound Name | 2-[1-[4-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]phenyl]piperidin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 166461455 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-[1-[4-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]phenyl]piperidin-4-yl]acetaldehyde |
| SMILES | C[C@@H]1CNc2c(sc3ccc4nc(-c5ccc(N6CCC(CC=O)CC6)cc5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C28H28N4O2S/c1-17-16-29-26-25-21-6-7-22(31-23(21)8-9-24(25)35-27(26)28(34)30-17)19-2-4-20(5-3-19)32-13-10-18(11-14-32)12-15-33/h2-9,15,17-18,29H,10-14,16H2,1H3,(H,30,34)/t17-/m1/s1 |
| InChIKey | CGQJUJKUAMOVRI-QGZVFWFLSA-N |
| XLogP | 5.47 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|