C25H26N6O2S — CID 177311157
2-[4-[4-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]pyrazol-1-yl]piperidin-1-yl]acetaldehyde (PubChem CID 177311157) has the molecular formula C25H26N6O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-[4-[4-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]pyrazol-1-yl]piperidin-1-yl]acetaldehyde.
| Compound Name | 2-[4-[4-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]pyrazol-1-yl]piperidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 177311157 |
| Molecular Formula | C25H26N6O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[4-[4-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]pyrazol-1-yl]piperidin-1-yl]acetaldehyde |
| SMILES | C[C@@H]1CNc2c(sc3ccc4nc(-c5cnn(C6CCN(CC=O)CC6)c5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C25H26N6O2S/c1-15-12-26-23-22-18-2-3-19(29-20(18)4-5-21(22)34-24(23)25(33)28-15)16-13-27-31(14-16)17-6-8-30(9-7-17)10-11-32/h2-5,11,13-15,17,26H,6-10,12H2,1H3,(H,28,33)/t15-/m1/s1 |
| InChIKey | OCBIWDZSXGGJQL-OAHLLOKOSA-N |
| XLogP | 3.69 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|