C26H21F3N6O2S — CID 170969663
N-[3-[(3,3-difluoroazetidin-1-yl)methyl]-2-fluoro-5-(13-oxo-11-thia-3,6,14,17-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide (PubChem CID 170969663) has the molecular formula C26H21F3N6O2S and a molecular weight of 538.56 g/mol. Its IUPAC name is N-[3-[(3,3-difluoroazetidin-1-yl)methyl]-2-fluoro-5-(13-oxo-11-thia-3,6,14,17-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-[(3,3-difluoroazetidin-1-yl)methyl]-2-fluoro-5-(13-oxo-11-thia-3,6,14,17-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170969663 |
| Molecular Formula | C26H21F3N6O2S |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | N-[3-[(3,3-difluoroazetidin-1-yl)methyl]-2-fluoro-5-(13-oxo-11-thia-3,6,14,17-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2cnc3c(ccc4sc5c(c43)NCCNC5=O)n2)cc(CN2CC(F)(F)C2)c1F |
| InChI | InChI=1S/C26H21F3N6O2S/c1-2-19(36)34-16-8-13(7-14(21(16)27)10-35-11-26(28,29)12-35)17-9-32-22-15(33-17)3-4-18-20(22)23-24(38-18)25(37)31-6-5-30-23/h2-4,7-9,30H,1,5-6,10-12H2,(H,31,37)(H,34,36) |
| InChIKey | CTLCQFGCTSOLIS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|