C28H39F4NO3 — CID 171841645
molecular hydrogen;(2,3,5,6-tetrafluorophenyl) 3-(2-hexyldecanoylamino)bicyclo[2.1.0]pent-3-ene-1-carboxylate (PubChem CID 171841645) has the molecular formula C28H39F4NO3 and a molecular weight of 513.62 g/mol. Its IUPAC name is molecular hydrogen;(2,3,5,6-tetrafluorophenyl) 3-(2-hexyldecanoylamino)bicyclo[2.1.0]pent-3-ene-1-carboxylate.
| Compound Name | molecular hydrogen;(2,3,5,6-tetrafluorophenyl) 3-(2-hexyldecanoylamino)bicyclo[2.1.0]pent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 171841645 |
| Molecular Formula | C28H39F4NO3 |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | molecular hydrogen;(2,3,5,6-tetrafluorophenyl) 3-(2-hexyldecanoylamino)bicyclo[2.1.0]pent-3-ene-1-carboxylate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)NC1=C2CC2(C(=O)Oc2c(F)c(F)cc(F)c2F)C1.[H][H] |
| InChI | InChI=1S/C28H37F4NO3.H2/c1-3-5-7-9-10-12-14-18(13-11-8-6-4-2)26(34)33-22-17-28(16-19(22)28)27(35)36-25-23(31)20(29)15-21(30)24(25)32;/h15,18H,3-14,16-17H2,1-2H3,(H,33,34);1H |
| InChIKey | PQPXHCHQTKRKRV-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|