C32H45BF4N2O6 — CID 171845219
tert-butyl 4-[3-cyclobutyloxy-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 171845219) has the molecular formula C32H45BF4N2O6 and a molecular weight of 640.52 g/mol. Its IUPAC name is tert-butyl 4-[3-cyclobutyloxy-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 4-[3-cyclobutyloxy-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 171845219 |
| Molecular Formula | C32H45BF4N2O6 |
| Molecular Weight | 640.52 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | tert-butyl 4-[3-cyclobutyloxy-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(c1c(/C=C(\F)B3OC(C)(C)C(C)(C)O3)ccc(OC3CCC3)c1C(F)(F)F)CCO2 |
| InChI | InChI=1S/C32H45BF4N2O6/c1-28(2,3)43-27(40)38-15-13-31(14-16-38)20-39(17-18-41-31)26-21(19-24(34)33-44-29(4,5)30(6,7)45-33)11-12-23(25(26)32(35,36)37)42-22-9-8-10-22/h11-12,19,22H,8-10,13-18,20H2,1-7H3/b24-19- |
| InChIKey | FAVYTGKZBLHWDR-CLCOLTQESA-N |
| XLogP | 7.18 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|