C34H43BF5N3O5 — CID 171630026
tert-butyl 2-[3-[(3-fluoro-2-pyridinyl)oxy]-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)phenyl]-2,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 171630026) has the molecular formula C34H43BF5N3O5 and a molecular weight of 679.54 g/mol. Its IUPAC name is tert-butyl 2-[3-[(3-fluoro-2-pyridinyl)oxy]-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)phenyl]-2,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 2-[3-[(3-fluoro-2-pyridinyl)oxy]-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)phenyl]-2,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 171630026 |
| Molecular Formula | C34H43BF5N3O5 |
| Molecular Weight | 679.54 g/mol |
| Exact Mass | 679.32 |
| IUPAC Name | tert-butyl 2-[3-[(3-fluoro-2-pyridinyl)oxy]-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)phenyl]-2,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCN(c3c(/C=C(\F)B4OC(C)(C)C(C)(C)O4)ccc(Oc4ncccc4F)c3C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C34H43BF5N3O5/c1-30(2,3)46-29(44)42-18-14-33(15-19-42)13-9-17-43(21-33)27-22(20-25(37)35-47-31(4,5)32(6,7)48-35)11-12-24(26(27)34(38,39)40)45-28-23(36)10-8-16-41-28/h8,10-12,16,20H,9,13-15,17-19,21H2,1-7H3/b25-20- |
| InChIKey | QVRFEKWHZIPHME-QQTULTPQSA-N |
| XLogP | 8.59 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.54 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|