C32H39BF6N2O5 — CID 171845195
tert-butyl (3R,4S)-3-fluoro-4-[3-(2-fluorophenoxy)-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-N-methyl-2-(trifluoromethyl)anilino]piperidine-1-carboxylate (PubChem CID 171845195) has the molecular formula C32H39BF6N2O5 and a molecular weight of 656.47 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-fluoro-4-[3-(2-fluorophenoxy)-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-N-methyl-2-(trifluoromethyl)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-fluoro-4-[3-(2-fluorophenoxy)-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-N-methyl-2-(trifluoromethyl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171845195 |
| Molecular Formula | C32H39BF6N2O5 |
| Molecular Weight | 656.47 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | tert-butyl (3R,4S)-3-fluoro-4-[3-(2-fluorophenoxy)-6-[(Z)-2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-N-methyl-2-(trifluoromethyl)anilino]piperidine-1-carboxylate |
| SMILES | CN(c1c(/C=C(\F)B2OC(C)(C)C(C)(C)O2)ccc(Oc2ccccc2F)c1C(F)(F)F)[C@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1F |
| InChI | InChI=1S/C32H39BF6N2O5/c1-29(2,3)44-28(42)41-16-15-22(21(35)18-41)40(8)27-19(17-25(36)33-45-30(4,5)31(6,7)46-33)13-14-24(26(27)32(37,38)39)43-23-12-10-9-11-20(23)34/h9-14,17,21-22H,15-16,18H2,1-8H3/b25-17-/t21-,22+/m1/s1 |
| InChIKey | KLGWZNWEOBIMPE-RIFXGYEJSA-N |
| XLogP | 8.36 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.47 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|