C23H30N6O5 — CID 171851150
2-N,1-bis(2,4-dimethoxyphenyl)-6-morpholin-4-yl-2H-1,3,5-triazine-2,4-diamine (PubChem CID 171851150) has the molecular formula C23H30N6O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-N,1-bis(2,4-dimethoxyphenyl)-6-morpholin-4-yl-2H-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,1-bis(2,4-dimethoxyphenyl)-6-morpholin-4-yl-2H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 171851150 |
| Molecular Formula | C23H30N6O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-N,1-bis(2,4-dimethoxyphenyl)-6-morpholin-4-yl-2H-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(NC2N=C(N)N=C(N3CCOCC3)N2c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C23H30N6O5/c1-30-15-5-7-17(19(13-15)32-3)25-22-26-21(24)27-23(28-9-11-34-12-10-28)29(22)18-8-6-16(31-2)14-20(18)33-4/h5-8,13-14,22,25H,9-12H2,1-4H3,(H2,24,26) |
| InChIKey | WUUIJOJVAPBKRW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|