C24H32N6O2 — CID 171851276
2-N-(4-ethoxyphenyl)-6-morpholin-4-yl-1-(4-propan-2-ylphenyl)-2H-1,3,5-triazine-2,4-diamine (PubChem CID 171851276) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-N-(4-ethoxyphenyl)-6-morpholin-4-yl-1-(4-propan-2-ylphenyl)-2H-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-ethoxyphenyl)-6-morpholin-4-yl-1-(4-propan-2-ylphenyl)-2H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 171851276 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 2-N-(4-ethoxyphenyl)-6-morpholin-4-yl-1-(4-propan-2-ylphenyl)-2H-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1ccc(NC2N=C(N)N=C(N3CCOCC3)N2c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H32N6O2/c1-4-32-21-11-7-19(8-12-21)26-23-27-22(25)28-24(29-13-15-31-16-14-29)30(23)20-9-5-18(6-10-20)17(2)3/h5-12,17,23,26H,4,13-16H2,1-3H3,(H2,25,27) |
| InChIKey | WJVXDJDFZZUFJR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|