C22H29ClN6O — CID 171851212
2-N-(4-ethoxyphenyl)-1-(3-methylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 171851212) has the molecular formula C22H29ClN6O and a molecular weight of 428.97 g/mol. Its IUPAC name is 2-N-(4-ethoxyphenyl)-1-(3-methylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-(4-ethoxyphenyl)-1-(3-methylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171851212 |
| Molecular Formula | C22H29ClN6O |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-N-(4-ethoxyphenyl)-1-(3-methylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | CCOc1ccc(NC2N=C(N)N=C(N3CCCC3)N2c2cccc(C)c2)cc1.Cl |
| InChI | InChI=1S/C22H28N6O.ClH/c1-3-29-19-11-9-17(10-12-19)24-21-25-20(23)26-22(27-13-4-5-14-27)28(21)18-8-6-7-16(2)15-18;/h6-12,15,21,24H,3-5,13-14H2,1-2H3,(H2,23,25);1H |
| InChIKey | KEKOYJOCQLPWCO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|