C22H28N6O3 — CID 171851167
2-N-(4-ethoxyphenyl)-1-(2-methoxyphenyl)-6-morpholin-4-yl-2H-1,3,5-triazine-2,4-diamine (PubChem CID 171851167) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-N-(4-ethoxyphenyl)-1-(2-methoxyphenyl)-6-morpholin-4-yl-2H-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-ethoxyphenyl)-1-(2-methoxyphenyl)-6-morpholin-4-yl-2H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 171851167 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-N-(4-ethoxyphenyl)-1-(2-methoxyphenyl)-6-morpholin-4-yl-2H-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1ccc(NC2N=C(N)N=C(N3CCOCC3)N2c2ccccc2OC)cc1 |
| InChI | InChI=1S/C22H28N6O3/c1-3-31-17-10-8-16(9-11-17)24-21-25-20(23)26-22(27-12-14-30-15-13-27)28(21)18-6-4-5-7-19(18)29-2/h4-11,21,24H,3,12-15H2,1-2H3,(H2,23,25) |
| InChIKey | HCGVMWGWRDGXCA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|