C65H99NO13S2 — CID 171853638
5-O-[3-[5-[2-[5-(dithiolan-3-yl)pentanoyloxy]octoxy]-5-oxopentanoyl]oxy-4-[[3-(9H-fluoren-9-ylmethoxy)-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] 1-O-(2-hexyldecyl) pentanedioate (PubChem CID 171853638) has the molecular formula C65H99NO13S2 and a molecular weight of 1166.63 g/mol. Its IUPAC name is 5-O-[3-[5-[2-[5-(dithiolan-3-yl)pentanoyloxy]octoxy]-5-oxopentanoyl]oxy-4-[[3-(9H-fluoren-9-ylmethoxy)-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] 1-O-(2-hexyldecyl) pentanedioate.
| Compound Name | 5-O-[3-[5-[2-[5-(dithiolan-3-yl)pentanoyloxy]octoxy]-5-oxopentanoyl]oxy-4-[[3-(9H-fluoren-9-ylmethoxy)-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] 1-O-(2-hexyldecyl) pentanedioate |
|---|---|
| PubChem CID | 171853638 |
| Molecular Formula | C65H99NO13S2 |
| Molecular Weight | 1166.63 g/mol |
| Exact Mass | 1165.66 |
| IUPAC Name | 5-O-[3-[5-[2-[5-(dithiolan-3-yl)pentanoyloxy]octoxy]-5-oxopentanoyl]oxy-4-[[3-(9H-fluoren-9-ylmethoxy)-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] 1-O-(2-hexyldecyl) pentanedioate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCC(=O)OCC(C)(C)C(OC(=O)CCCC(=O)OCC(CCCCCC)OC(=O)CCCCC1CCSS1)C(=O)NCCC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C65H99NO13S2/c1-6-9-12-15-16-18-29-49(28-17-13-10-7-2)45-74-57(67)37-26-39-59(69)77-48-65(4,5)63(64(73)66-43-41-60(70)76-47-56-54-34-23-21-32-52(54)53-33-22-24-35-55(53)56)79-62(72)40-27-38-58(68)75-46-50(30-19-14-11-8-3)78-61(71)36-25-20-31-51-42-44-80-81-51/h21-24,32-35,49-51,56,63H,6-20,25-31,36-48H2,1-5H3,(H,66,73) |
| InChIKey | ZYMZFMVBCLQPED-UHFFFAOYSA-N |
| XLogP | 14.69 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1166.63 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|