C51H89NO13S2 — CID 171758209
3-[[2-[5-[2-[5-(dithiolan-3-yl)pentanoyloxy]octoxy]-5-oxopentanoyl]oxy-4-[5-(2-hexyldecoxy)-5-oxopentanoyl]oxy-3,3-dimethylbutanoyl]amino]propanoic acid (PubChem CID 171758209) has the molecular formula C51H89NO13S2 and a molecular weight of 988.40 g/mol. Its IUPAC name is 3-[[2-[5-[2-[5-(dithiolan-3-yl)pentanoyloxy]octoxy]-5-oxopentanoyl]oxy-4-[5-(2-hexyldecoxy)-5-oxopentanoyl]oxy-3,3-dimethylbutanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-[5-[2-[5-(dithiolan-3-yl)pentanoyloxy]octoxy]-5-oxopentanoyl]oxy-4-[5-(2-hexyldecoxy)-5-oxopentanoyl]oxy-3,3-dimethylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 171758209 |
| Molecular Formula | C51H89NO13S2 |
| Molecular Weight | 988.40 g/mol |
| Exact Mass | 987.58 |
| IUPAC Name | 3-[[2-[5-[2-[5-(dithiolan-3-yl)pentanoyloxy]octoxy]-5-oxopentanoyl]oxy-4-[5-(2-hexyldecoxy)-5-oxopentanoyl]oxy-3,3-dimethylbutanoyl]amino]propanoic acid |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCC(=O)OCC(C)(C)C(OC(=O)CCCC(=O)OCC(CCCCCC)OC(=O)CCCCC1CCSS1)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C51H89NO13S2/c1-6-9-12-15-16-18-25-40(24-17-13-10-7-2)37-61-44(55)29-22-31-46(57)63-39-51(4,5)49(50(60)52-35-33-43(53)54)65-48(59)32-23-30-45(56)62-38-41(26-19-14-11-8-3)64-47(58)28-21-20-27-42-34-36-66-67-42/h40-42,49H,6-39H2,1-5H3,(H,52,60)(H,53,54) |
| InChIKey | SOQCCURLQNZEIW-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 197.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.40 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|