C51H92N2O11S2 — CID 171758219
5-O-[(2R)-4-[3-(dimethylamino)propanoyloxy]-1-[[3-(2-hexyldecoxy)-3-oxopropyl]amino]-3,3-dimethyl-1-oxobutan-2-yl] 1-O-[2-[5-(dithiolan-3-yl)pentanoyloxy]octyl] pentanedioate (PubChem CID 171758219) has the molecular formula C51H92N2O11S2 and a molecular weight of 973.43 g/mol. Its IUPAC name is 5-O-[(2R)-4-[3-(dimethylamino)propanoyloxy]-1-[[3-(2-hexyldecoxy)-3-oxopropyl]amino]-3,3-dimethyl-1-oxobutan-2-yl] 1-O-[2-[5-(dithiolan-3-yl)pentanoyloxy]octyl] pentanedioate.
| Compound Name | 5-O-[(2R)-4-[3-(dimethylamino)propanoyloxy]-1-[[3-(2-hexyldecoxy)-3-oxopropyl]amino]-3,3-dimethyl-1-oxobutan-2-yl] 1-O-[2-[5-(dithiolan-3-yl)pentanoyloxy]octyl] pentanedioate |
|---|---|
| PubChem CID | 171758219 |
| Molecular Formula | C51H92N2O11S2 |
| Molecular Weight | 973.43 g/mol |
| Exact Mass | 972.61 |
| IUPAC Name | 5-O-[(2R)-4-[3-(dimethylamino)propanoyloxy]-1-[[3-(2-hexyldecoxy)-3-oxopropyl]amino]-3,3-dimethyl-1-oxobutan-2-yl] 1-O-[2-[5-(dithiolan-3-yl)pentanoyloxy]octyl] pentanedioate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCNC(=O)[C@H](OC(=O)CCCC(=O)OCC(CCCCCC)OC(=O)CCCCC1CCSS1)C(C)(C)COC(=O)CCN(C)C |
| InChI | InChI=1S/C51H92N2O11S2/c1-8-11-14-17-18-20-26-41(25-19-15-12-9-2)38-60-45(55)32-35-52-50(59)49(51(4,5)40-62-46(56)33-36-53(6)7)64-48(58)31-24-30-44(54)61-39-42(27-21-16-13-10-3)63-47(57)29-23-22-28-43-34-37-65-66-43/h41-43,49H,8-40H2,1-7H3,(H,52,59)/t41?,42?,43?,49-/m0/s1 |
| InChIKey | XNLXMMFPDSJXNF-AVDIKDHBSA-N |
| XLogP | 11.12 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.43 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|