C9H13N3O3 — CID 171867840
3-(3-hydrazinylphenyl)-2,3-dihydroxypropanamide (PubChem CID 171867840) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-(3-hydrazinylphenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(3-hydrazinylphenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171867840 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-(3-hydrazinylphenyl)-2,3-dihydroxypropanamide |
| SMILES | NNc1cccc(C(O)C(O)C(N)=O)c1 |
| InChI | InChI=1S/C9H13N3O3/c10-9(15)8(14)7(13)5-2-1-3-6(4-5)12-11/h1-4,7-8,12-14H,11H2,(H2,10,15) |
| InChIKey | CABQXCNIJGIKPW-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|