C11H14N2O5 — CID 171868834
methyl 2-amino-5-(3-amino-1,2-dihydroxy-3-oxopropyl)benzoate (PubChem CID 171868834) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is methyl 2-amino-5-(3-amino-1,2-dihydroxy-3-oxopropyl)benzoate.
| Compound Name | methyl 2-amino-5-(3-amino-1,2-dihydroxy-3-oxopropyl)benzoate |
|---|---|
| PubChem CID | 171868834 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | methyl 2-amino-5-(3-amino-1,2-dihydroxy-3-oxopropyl)benzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)C(N)=O)ccc1N |
| InChI | InChI=1S/C11H14N2O5/c1-18-11(17)6-4-5(2-3-7(6)12)8(14)9(15)10(13)16/h2-4,8-9,14-15H,12H2,1H3,(H2,13,16) |
| InChIKey | OLJKIBYWLHGZIT-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|