C23H24N4O4S — CID 17187324
N-cyclohexyl-3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzamide (PubChem CID 17187324) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-cyclohexyl-3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzamide.
| Compound Name | N-cyclohexyl-3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17187324 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-cyclohexyl-3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NC(=S)Nc1cccc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C23H24N4O4S/c28-21(14-11-16-9-12-20(13-10-16)27(30)31)26-23(32)25-19-8-4-5-17(15-19)22(29)24-18-6-2-1-3-7-18/h4-5,8-15,18H,1-3,6-7H2,(H,24,29)(H2,25,26,28,32)/b14-11+ |
| InChIKey | LSNLPSYMWOKCNL-SDNWHVSQSA-N |
| XLogP | 4.18 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|