C22H23Br2ClN2O3 — CID 17188450
2-chloro-N-cyclohexyl-5-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzamide (PubChem CID 17188450) has the molecular formula C22H23Br2ClN2O3 and a molecular weight of 558.70 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17188450 |
| Molecular Formula | C22H23Br2ClN2O3 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 555.98 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C22H23Br2ClN2O3/c1-13-9-14(23)10-18(24)21(13)30-12-20(28)26-16-7-8-19(25)17(11-16)22(29)27-15-5-3-2-4-6-15/h7-11,15H,2-6,12H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | DNAOWZGIKHQLQP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |