C28H23Cl2NO3 — CID 171905423
1-[1,3-bis(4-chlorophenyl)-4,9-dihydroxy-1,3-dihydrobenzo[de]isoquinolin-2-yl]butan-1-one (PubChem CID 171905423) has the molecular formula C28H23Cl2NO3 and a molecular weight of 492.40 g/mol. Its IUPAC name is 1-[1,3-bis(4-chlorophenyl)-4,9-dihydroxy-1,3-dihydrobenzo[de]isoquinolin-2-yl]butan-1-one.
| Compound Name | 1-[1,3-bis(4-chlorophenyl)-4,9-dihydroxy-1,3-dihydrobenzo[de]isoquinolin-2-yl]butan-1-one |
|---|---|
| PubChem CID | 171905423 |
| Molecular Formula | C28H23Cl2NO3 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 1-[1,3-bis(4-chlorophenyl)-4,9-dihydroxy-1,3-dihydrobenzo[de]isoquinolin-2-yl]butan-1-one |
| SMILES | CCCC(=O)N1C(c2ccc(Cl)cc2)c2c(O)ccc3ccc(O)c(c23)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H23Cl2NO3/c1-2-3-23(34)31-27(17-4-10-19(29)11-5-17)25-21(32)14-8-16-9-15-22(33)26(24(16)25)28(31)18-6-12-20(30)13-7-18/h4-15,27-28,32-33H,2-3H2,1H3 |
| InChIKey | YMVDLEPUPNRZGX-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|