C20H20ClN3O2S — CID 171906912
4-[3-chloro-4-(2-phenylpyrrolidin-1-yl)sulfonylphenyl]-1-methylpyrazole (PubChem CID 171906912) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 4-[3-chloro-4-(2-phenylpyrrolidin-1-yl)sulfonylphenyl]-1-methylpyrazole.
| Compound Name | 4-[3-chloro-4-(2-phenylpyrrolidin-1-yl)sulfonylphenyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 171906912 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-[3-chloro-4-(2-phenylpyrrolidin-1-yl)sulfonylphenyl]-1-methylpyrazole |
| SMILES | Cn1cc(-c2ccc(S(=O)(=O)N3CCCC3c3ccccc3)c(Cl)c2)cn1 |
| InChI | InChI=1S/C20H20ClN3O2S/c1-23-14-17(13-22-23)16-9-10-20(18(21)12-16)27(25,26)24-11-5-8-19(24)15-6-3-2-4-7-15/h2-4,6-7,9-10,12-14,19H,5,8,11H2,1H3 |
| InChIKey | PXBGMBRHAVXGAT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |