About 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile
1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile (PubChem CID 171929199) has the molecular formula C10H11F3N4O2S
and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile.
Molecular Properties
| Compound Name | 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile |
| PubChem CID | 171929199 |
| Molecular Formula | C10H11F3N4O2S |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile |
| SMILES | CCn1ccnc1C.N#CC(C#N)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10N2.C4HF3N2O2S/c1-3-8-5-4-7-6(8)2;5-4(6,7)12(10,11)3(1-8)2-9/h4-5H,3H2,1-2H3;3H |
| InChIKey | FIUYRYJNQUZCTB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile?
The IUPAC name of 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile (CID 171929199) is 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile.
What is the SMILES notation for 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile?
The canonical SMILES for 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile is CCn1ccnc1C.N#CC(C#N)S(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile?
The InChIKey is FIUYRYJNQUZCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C4HF3N2O2S/c1-3-8-5-4-7-6(8)2;5-4(6,7)12(10,11)3(1-8)2-9/h4-5H,3H2,1-2H3;3H.
What are the key properties of 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile?
1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile has a molecular weight of 308.29 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methylimidazole;2-(trifluoromethylsulfonyl)propanedinitrile is sourced from PubChem (CID 171929199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).