C26H23F6N3O3 — CID 171930984
N-(1-adamantyl)-3-(2,3,4-trifluorophenyl)imidazo[1,5-a]pyridine-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171930984) has the molecular formula C26H23F6N3O3 and a molecular weight of 539.48 g/mol. Its IUPAC name is N-(1-adamantyl)-3-(2,3,4-trifluorophenyl)imidazo[1,5-a]pyridine-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(1-adamantyl)-3-(2,3,4-trifluorophenyl)imidazo[1,5-a]pyridine-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171930984 |
| Molecular Formula | C26H23F6N3O3 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | N-(1-adamantyl)-3-(2,3,4-trifluorophenyl)imidazo[1,5-a]pyridine-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1nc(-c2ccc(F)c(F)c2F)n2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H22F3N3O.C2HF3O2/c25-17-5-4-16(19(26)20(17)27)22-28-21(18-3-1-2-6-30(18)22)23(31)29-24-10-13-7-14(11-24)9-15(8-13)12-24;3-2(4,5)1(6)7/h1-6,13-15H,7-12H2,(H,29,31);(H,6,7) |
| InChIKey | WXDVOOYMELUFTH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|