C23H25N4O2+ — CID 136503779
N-(1-adamantyl)-3-(1-hydroxypyridin-1-ium-2-yl)imidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 136503779) has the molecular formula C23H25N4O2+ and a molecular weight of 389.48 g/mol. Its IUPAC name is N-(1-adamantyl)-3-(1-hydroxypyridin-1-ium-2-yl)imidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-(1-adamantyl)-3-(1-hydroxypyridin-1-ium-2-yl)imidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 136503779 |
| Molecular Formula | C23H25N4O2+ |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-(1-adamantyl)-3-(1-hydroxypyridin-1-ium-2-yl)imidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1nc(-c2cccc[n+]2O)n2ccccc12 |
| InChI | InChI=1S/C23H24N4O2/c28-22(25-23-12-15-9-16(13-23)11-17(10-15)14-23)20-18-5-1-3-7-26(18)21(24-20)19-6-2-4-8-27(19)29/h1-8,15-17H,9-14H2,(H-,24,25,28,29)/p+1 |
| InChIKey | GLWKORZXDLOWQM-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|