C24H24FN3O — CID 69005872
N-(1-adamantyl)-1-(2-fluorophenyl)imidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 69005872) has the molecular formula C24H24FN3O and a molecular weight of 389.47 g/mol. Its IUPAC name is N-(1-adamantyl)-1-(2-fluorophenyl)imidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(1-adamantyl)-1-(2-fluorophenyl)imidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69005872 |
| Molecular Formula | C24H24FN3O |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-(1-adamantyl)-1-(2-fluorophenyl)imidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1nc(-c2ccccc2F)c2ccccn12 |
| InChI | InChI=1S/C24H24FN3O/c25-19-6-2-1-5-18(19)21-20-7-3-4-8-28(20)22(26-21)23(29)27-24-12-15-9-16(13-24)11-17(10-15)14-24/h1-8,15-17H,9-14H2,(H,27,29) |
| InChIKey | LBAHRRQINLVGMO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |