C24H24FN3O2 — CID 70944077
N-(1-adamantyl)-3-(2-fluorophenoxy)imidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 70944077) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is N-(1-adamantyl)-3-(2-fluorophenoxy)imidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-(1-adamantyl)-3-(2-fluorophenoxy)imidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 70944077 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-(1-adamantyl)-3-(2-fluorophenoxy)imidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1nc(Oc2ccccc2F)n2ccccc12 |
| InChI | InChI=1S/C24H24FN3O2/c25-18-5-1-2-7-20(18)30-23-26-21(19-6-3-4-8-28(19)23)22(29)27-24-12-15-9-16(13-24)11-17(10-15)14-24/h1-8,15-17H,9-14H2,(H,27,29) |
| InChIKey | SFJRJUOKATVCQJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |