C26H29F3N4O5 — CID 171931492
tert-butyl N-[(2R)-5-[[N-hydroxy-C-(2-oxo-1,3-dihydroindol-5-yl)carbonimidoyl]amino]-5-oxo-1-[4-(trifluoromethyl)phenyl]pentan-2-yl]carbamate (PubChem CID 171931492) has the molecular formula C26H29F3N4O5 and a molecular weight of 534.54 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-[[N-hydroxy-C-(2-oxo-1,3-dihydroindol-5-yl)carbonimidoyl]amino]-5-oxo-1-[4-(trifluoromethyl)phenyl]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-[[N-hydroxy-C-(2-oxo-1,3-dihydroindol-5-yl)carbonimidoyl]amino]-5-oxo-1-[4-(trifluoromethyl)phenyl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 171931492 |
| Molecular Formula | C26H29F3N4O5 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | tert-butyl N-[(2R)-5-[[N-hydroxy-C-(2-oxo-1,3-dihydroindol-5-yl)carbonimidoyl]amino]-5-oxo-1-[4-(trifluoromethyl)phenyl]pentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)NC(=NO)c1ccc2c(c1)CC(=O)N2)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H29F3N4O5/c1-25(2,3)38-24(36)30-19(12-15-4-7-18(8-5-15)26(27,28)29)9-11-21(34)32-23(33-37)16-6-10-20-17(13-16)14-22(35)31-20/h4-8,10,13,19,37H,9,11-12,14H2,1-3H3,(H,30,36)(H,31,35)(H,32,33,34)/t19-/m1/s1 |
| InChIKey | CXWPTXBFMDUOPM-LJQANCHMSA-N |
| XLogP | 4.37 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|