C14H17F3N2O3S — CID 171931505
3-[2-methyl-5-(trifluoromethyl)-3H-benzimidazol-1-ium-1-yl]pentane-1-sulfonate (PubChem CID 171931505) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is 3-[2-methyl-5-(trifluoromethyl)-3H-benzimidazol-1-ium-1-yl]pentane-1-sulfonate.
| Compound Name | 3-[2-methyl-5-(trifluoromethyl)-3H-benzimidazol-1-ium-1-yl]pentane-1-sulfonate |
|---|---|
| PubChem CID | 171931505 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-[2-methyl-5-(trifluoromethyl)-3H-benzimidazol-1-ium-1-yl]pentane-1-sulfonate |
| SMILES | CCC(CCS(=O)(=O)[O-])[n+]1c(C)[nH]c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H17F3N2O3S/c1-3-11(6-7-23(20,21)22)19-9(2)18-12-8-10(14(15,16)17)4-5-13(12)19/h4-5,8,11H,3,6-7H2,1-2H3,(H,20,21,22) |
| InChIKey | DKWPPNDJDODWSU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|