About 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide
2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 171931640) has the molecular formula C9H13F6N3O4S2
and a molecular weight of 405.34 g/mol. Its IUPAC name is 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
Molecular Properties
| Compound Name | 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| PubChem CID | 171931640 |
| Molecular Formula | C9H13F6N3O4S2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | N#CCN1CCCCC1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H12N2.C2HF6NO4S2/c8-4-7-9-5-2-1-3-6-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1-3,5-7H2;9H |
| InChIKey | FDATVBCDZFYFPD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The IUPAC name of 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (CID 171931640) is 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
What is the SMILES notation for 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The canonical SMILES for 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide is N#CCN1CCCCC1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The InChIKey is FDATVBCDZFYFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C2HF6NO4S2/c8-4-7-9-5-2-1-3-6-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1-3,5-7H2;9H.
What are the key properties of 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide has a molecular weight of 405.34 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylacetonitrile;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide is sourced from PubChem (CID 171931640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).