C12H21F6N5O6S2 — CID 171932717
1-(3-azidobutyl)-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonate;trifluoromethanesulfonic acid (PubChem CID 171932717) has the molecular formula C12H21F6N5O6S2 and a molecular weight of 509.45 g/mol. Its IUPAC name is 1-(3-azidobutyl)-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonate;trifluoromethanesulfonic acid.
| Compound Name | 1-(3-azidobutyl)-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 171932717 |
| Molecular Formula | C12H21F6N5O6S2 |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 1-(3-azidobutyl)-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonate;trifluoromethanesulfonic acid |
| SMILES | CC(CC[N+]12CCN(CC1)CC2)N=[N+]=[N-].O=S(=O)(O)C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H20N5.2CHF3O3S/c1-10(12-13-11)2-6-15-7-3-14(4-8-15)5-9-15;2*2-1(3,4)8(5,6)7/h10H,2-9H2,1H3;2*(H,5,6,7)/q+1;;/p-1 |
| InChIKey | OYIKEBHIZPAVEZ-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 163.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|