C9H18F3N2O3S+ — CID 88506176
1,2-dimethyl-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid (PubChem CID 88506176) has the molecular formula C9H18F3N2O3S+ and a molecular weight of 291.31 g/mol. Its IUPAC name is 1,2-dimethyl-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid.
| Compound Name | 1,2-dimethyl-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 88506176 |
| Molecular Formula | C9H18F3N2O3S+ |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1,2-dimethyl-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid |
| SMILES | CC1CN2CC[N+]1(C)CC2.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H17N2.CHF3O3S/c1-8-7-9-3-5-10(8,2)6-4-9;2-1(3,4)8(5,6)7/h8H,3-7H2,1-2H3;(H,5,6,7)/q+1; |
| InChIKey | LNJXUYOIEHXAPE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|