C17H25NOSi — CID 171941310
8-azabicyclo[3.2.1]octan-3-yl-(4-trimethylsilylphenyl)methanone (PubChem CID 171941310) has the molecular formula C17H25NOSi and a molecular weight of 287.48 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-yl-(4-trimethylsilylphenyl)methanone.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-yl-(4-trimethylsilylphenyl)methanone |
|---|---|
| PubChem CID | 171941310 |
| Molecular Formula | C17H25NOSi |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-yl-(4-trimethylsilylphenyl)methanone |
| SMILES | C[Si](C)(C)c1ccc(C(=O)C2CC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C17H25NOSi/c1-20(2,3)16-8-4-12(5-9-16)17(19)13-10-14-6-7-15(11-13)18-14/h4-5,8-9,13-15,18H,6-7,10-11H2,1-3H3 |
| InChIKey | IHDBPEOZIUWWTC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|