C17H18F5NO2 — CID 171939607
9-azabicyclo[3.3.1]nonan-3-yl-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methanone (PubChem CID 171939607) has the molecular formula C17H18F5NO2 and a molecular weight of 363.33 g/mol. Its IUPAC name is 9-azabicyclo[3.3.1]nonan-3-yl-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methanone.
| Compound Name | 9-azabicyclo[3.3.1]nonan-3-yl-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 171939607 |
| Molecular Formula | C17H18F5NO2 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 9-azabicyclo[3.3.1]nonan-3-yl-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)(F)C(F)(F)F)cc1)C1CC2CCCC(C1)N2 |
| InChI | InChI=1S/C17H18F5NO2/c18-16(19,20)17(21,22)25-14-6-4-10(5-7-14)15(24)11-8-12-2-1-3-13(9-11)23-12/h4-7,11-13,23H,1-3,8-9H2 |
| InChIKey | PMASOTVDEYKWLX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|