About (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one
(E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one (PubChem CID 171948029) has the molecular formula C18H22O2S
and a molecular weight of 302.44 g/mol. Its IUPAC name is (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one |
| PubChem CID | 171948029 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one |
| SMILES | O=C(C/C=C/c1ccccc1)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C18H22O2S/c19-18(11-4-8-14-6-2-1-3-7-14)15-12-16-9-5-10-17(13-15)21(16)20/h1-4,6-8,15-17H,5,9-13H2/b8-4+ |
| InChIKey | RFLAXDMWKGOBHA-XBXARRHUSA-N |
| XLogP | 3.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one?
The IUPAC name of (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one (CID 171948029) is (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one.
What is the SMILES notation for (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one?
The canonical SMILES for (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one is O=C(C/C=C/c1ccccc1)C1CC2CCCC(C1)S2=O.
What is the InChIKey of (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one?
The InChIKey is RFLAXDMWKGOBHA-XBXARRHUSA-N. The full InChI is InChI=1S/C18H22O2S/c19-18(11-4-8-14-6-2-1-3-7-14)15-12-16-9-5-10-17(13-15)21(16)20/h1-4,6-8,15-17H,5,9-13H2/b8-4+.
What are the key properties of (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one?
(E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one has a molecular weight of 302.44 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-phenylbut-3-en-1-one is sourced from PubChem (CID 171948029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).