C15H20OS — CID 171958723
3-(2,3-dimethylphenyl)-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171958723) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2,3-dimethylphenyl)-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171958723 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | Cc1cccc(C2(O)CC3CCC(C2)S3)c1C |
| InChI | InChI=1S/C15H20OS/c1-10-4-3-5-14(11(10)2)15(16)8-12-6-7-13(9-15)17-12/h3-5,12-13,16H,6-9H2,1-2H3 |
| InChIKey | MOJGXNMNRVFDAA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |