C15H19F2NO2 — CID 171963260
3-[[3-(difluoromethoxy)phenyl]methyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171963260) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-[[3-(difluoromethoxy)phenyl]methyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[[3-(difluoromethoxy)phenyl]methyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171963260 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-[[3-(difluoromethoxy)phenyl]methyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(Cc2cccc(OC(F)F)c2)CC2CCC(C1)N2 |
| InChI | InChI=1S/C15H19F2NO2/c16-14(17)20-13-3-1-2-10(6-13)7-15(19)8-11-4-5-12(9-15)18-11/h1-3,6,11-12,14,18-19H,4-5,7-9H2 |
| InChIKey | XOLJIKVJWCJJEY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |